About 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one
2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one (PubChem CID 10261919) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 10261919 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc2c(=O)nc(N)nc-2n1C |
| InChI | InChI=1S/C9H10N4O/c1-5-3-4-6-7(13(5)2)11-9(10)12-8(6)14/h3-4H,1-2H3,(H2,10,12,14) |
| InChIKey | OIWOLRXVAKNAAO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one (CID 10261919) is 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one is Cc1ccc2c(=O)nc(N)nc-2n1C.
What is the InChIKey of 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one?
The InChIKey is OIWOLRXVAKNAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-5-3-4-6-7(13(5)2)11-9(10)12-8(6)14/h3-4H,1-2H3,(H2,10,12,14).
What are the key properties of 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one?
2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one has a molecular weight of 190.21 g/mol, XLogP of 0.17, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,8-dimethylpyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 10261919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).