C16H17ClF2N2 — CID 102619227
N-[2-(2-chloro-5-fluorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine (PubChem CID 102619227) has the molecular formula C16H17ClF2N2 and a molecular weight of 310.77 g/mol. Its IUPAC name is N-[2-(2-chloro-5-fluorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-chloro-5-fluorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102619227 |
| Molecular Formula | C16H17ClF2N2 |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-[2-(2-chloro-5-fluorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(F)ccc1Cl)c1ccncc1F |
| InChI | InChI=1S/C16H17ClF2N2/c1-2-6-21-16(13-5-7-20-10-15(13)19)9-11-8-12(18)3-4-14(11)17/h3-5,7-8,10,16,21H,2,6,9H2,1H3 |
| InChIKey | WJILDHAHHHXADS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |