C14H18O3S — CID 102620782
13-tricyclo[8.2.1.03,8]trideca-3,5,7-trienyl methanesulfonate (PubChem CID 102620782) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 13-tricyclo[8.2.1.03,8]trideca-3,5,7-trienyl methanesulfonate.
| Compound Name | 13-tricyclo[8.2.1.03,8]trideca-3,5,7-trienyl methanesulfonate |
|---|---|
| PubChem CID | 102620782 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 13-tricyclo[8.2.1.03,8]trideca-3,5,7-trienyl methanesulfonate |
| SMILES | CS(=O)(=O)OC1C2CCC1Cc1ccccc1C2 |
| InChI | InChI=1S/C14H18O3S/c1-18(15,16)17-14-12-6-7-13(14)9-11-5-3-2-4-10(11)8-12/h2-5,12-14H,6-9H2,1H3 |
| InChIKey | YDBXIYOTIRKLFS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|