C8H12N4S — CID 10262099
1,4-diamino-5,6,7,8-tetrahydroquinazoline-2-thione (PubChem CID 10262099) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 1,4-diamino-5,6,7,8-tetrahydroquinazoline-2-thione.
| Compound Name | 1,4-diamino-5,6,7,8-tetrahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 10262099 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1,4-diamino-5,6,7,8-tetrahydroquinazoline-2-thione |
| SMILES | Nc1nc(=S)n(N)c2c1CCCC2 |
| InChI | InChI=1S/C8H12N4S/c9-7-5-3-1-2-4-6(5)12(10)8(13)11-7/h1-4,10H2,(H2,9,11,13) |
| InChIKey | VUSPUMNJMXLSDD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|