About (2,3-dichlorophenyl)methyl trifluoromethanesulfonate
(2,3-dichlorophenyl)methyl trifluoromethanesulfonate (PubChem CID 102621306) has the molecular formula C8H5Cl2F3O3S
and a molecular weight of 309.09 g/mol. Its IUPAC name is (2,3-dichlorophenyl)methyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2,3-dichlorophenyl)methyl trifluoromethanesulfonate |
| PubChem CID | 102621306 |
| Molecular Formula | C8H5Cl2F3O3S |
| Molecular Weight | 309.09 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | (2,3-dichlorophenyl)methyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCc1cccc(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C8H5Cl2F3O3S/c9-6-3-1-2-5(7(6)10)4-16-17(14,15)8(11,12)13/h1-3H,4H2 |
| InChIKey | KAACUYIRXDHHKA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dichlorophenyl)methyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichlorophenyl)methyl trifluoromethanesulfonate?
The IUPAC name of (2,3-dichlorophenyl)methyl trifluoromethanesulfonate (CID 102621306) is (2,3-dichlorophenyl)methyl trifluoromethanesulfonate.
What is the SMILES notation for (2,3-dichlorophenyl)methyl trifluoromethanesulfonate?
The canonical SMILES for (2,3-dichlorophenyl)methyl trifluoromethanesulfonate is O=S(=O)(OCc1cccc(Cl)c1Cl)C(F)(F)F.
What is the InChIKey of (2,3-dichlorophenyl)methyl trifluoromethanesulfonate?
The InChIKey is KAACUYIRXDHHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2F3O3S/c9-6-3-1-2-5(7(6)10)4-16-17(14,15)8(11,12)13/h1-3H,4H2.
What are the key properties of (2,3-dichlorophenyl)methyl trifluoromethanesulfonate?
(2,3-dichlorophenyl)methyl trifluoromethanesulfonate has a molecular weight of 309.09 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichlorophenyl)methyl trifluoromethanesulfonate is sourced from PubChem (CID 102621306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).