C17H16ClFO — CID 102622334
1-(2-chloro-5-fluorophenyl)-4-(4-methylphenyl)butan-2-one (PubChem CID 102622334) has the molecular formula C17H16ClFO and a molecular weight of 290.77 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-4-(4-methylphenyl)butan-2-one.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-4-(4-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 102622334 |
| Molecular Formula | C17H16ClFO |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-4-(4-methylphenyl)butan-2-one |
| SMILES | Cc1ccc(CCC(=O)Cc2cc(F)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClFO/c1-12-2-4-13(5-3-12)6-8-16(20)11-14-10-15(19)7-9-17(14)18/h2-5,7,9-10H,6,8,11H2,1H3 |
| InChIKey | CMFAFQGOHQTQIA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |