C16H16ClFIN — CID 102622580
2-(2-chloro-5-fluorophenyl)-N-ethyl-1-(4-iodophenyl)ethanamine (PubChem CID 102622580) has the molecular formula C16H16ClFIN and a molecular weight of 403.67 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-N-ethyl-1-(4-iodophenyl)ethanamine.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-N-ethyl-1-(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 102622580 |
| Molecular Formula | C16H16ClFIN |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-N-ethyl-1-(4-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1cc(F)ccc1Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H16ClFIN/c1-2-20-16(11-3-6-14(19)7-4-11)10-12-9-13(18)5-8-15(12)17/h3-9,16,20H,2,10H2,1H3 |
| InChIKey | JTFZBBUXKOGJKR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|