C17H19ClFN — CID 102622705
2-(2-chloro-5-fluorophenyl)-1-(2-ethylphenyl)-N-methylethanamine (PubChem CID 102622705) has the molecular formula C17H19ClFN and a molecular weight of 291.80 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-1-(2-ethylphenyl)-N-methylethanamine.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-1-(2-ethylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 102622705 |
| Molecular Formula | C17H19ClFN |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-1-(2-ethylphenyl)-N-methylethanamine |
| SMILES | CCc1ccccc1C(Cc1cc(F)ccc1Cl)NC |
| InChI | InChI=1S/C17H19ClFN/c1-3-12-6-4-5-7-15(12)17(20-2)11-13-10-14(19)8-9-16(13)18/h4-10,17,20H,3,11H2,1-2H3 |
| InChIKey | OLZYYOZZRYCMIF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |