About 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane
2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane (PubChem CID 10262309) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 10262309 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane |
| SMILES | c1cncc(N2CCC3(CCNC3)C2)c1 |
| InChI | InChI=1S/C12H17N3/c1-2-11(8-13-5-1)15-7-4-12(10-15)3-6-14-9-12/h1-2,5,8,14H,3-4,6-7,9-10H2 |
| InChIKey | VDJKJWWRXHDLDM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane (CID 10262309) is 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane is c1cncc(N2CCC3(CCNC3)C2)c1.
What is the InChIKey of 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane?
The InChIKey is VDJKJWWRXHDLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-2-11(8-13-5-1)15-7-4-12(10-15)3-6-14-9-12/h1-2,5,8,14H,3-4,6-7,9-10H2.
What are the key properties of 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane?
2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane has a molecular weight of 203.29 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yl-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 10262309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).