About 4-[(E)-oct-3-enyl]phenol
4-[(E)-oct-3-enyl]phenol (PubChem CID 10262345) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 4-[(E)-oct-3-enyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-oct-3-enyl]phenol |
| PubChem CID | 10262345 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 4-[(E)-oct-3-enyl]phenol |
| SMILES | CCCC/C=C/CCc1ccc(O)cc1 |
| InChI | InChI=1S/C14H20O/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h5-6,9-12,15H,2-4,7-8H2,1H3/b6-5+ |
| InChIKey | UTXMWVVQOZAGKZ-AATRIKPKSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-oct-3-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-oct-3-enyl]phenol?
The IUPAC name of 4-[(E)-oct-3-enyl]phenol (CID 10262345) is 4-[(E)-oct-3-enyl]phenol.
What is the SMILES notation for 4-[(E)-oct-3-enyl]phenol?
The canonical SMILES for 4-[(E)-oct-3-enyl]phenol is CCCC/C=C/CCc1ccc(O)cc1.
What is the InChIKey of 4-[(E)-oct-3-enyl]phenol?
The InChIKey is UTXMWVVQOZAGKZ-AATRIKPKSA-N. The full InChI is InChI=1S/C14H20O/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h5-6,9-12,15H,2-4,7-8H2,1H3/b6-5+.
What are the key properties of 4-[(E)-oct-3-enyl]phenol?
4-[(E)-oct-3-enyl]phenol has a molecular weight of 204.31 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-oct-3-enyl]phenol is sourced from PubChem (CID 10262345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).