C14H17N5 — CID 102624011
2-[2-amino-5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]phenyl]acetonitrile (PubChem CID 102624011) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[2-amino-5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624011 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[2-amino-5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]phenyl]acetonitrile |
| SMILES | CN(Cc1cnn(C)c1)c1ccc(N)c(CC#N)c1 |
| InChI | InChI=1S/C14H17N5/c1-18(9-11-8-17-19(2)10-11)13-3-4-14(16)12(7-13)5-6-15/h3-4,7-8,10H,5,9,16H2,1-2H3 |
| InChIKey | CDRCZGUPSIXDOX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|