C14H11Br2N3 — CID 102624038
2-[2-amino-5-(2,4-dibromoanilino)phenyl]acetonitrile (PubChem CID 102624038) has the molecular formula C14H11Br2N3 and a molecular weight of 381.07 g/mol. Its IUPAC name is 2-[2-amino-5-(2,4-dibromoanilino)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(2,4-dibromoanilino)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624038 |
| Molecular Formula | C14H11Br2N3 |
| Molecular Weight | 381.07 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 2-[2-amino-5-(2,4-dibromoanilino)phenyl]acetonitrile |
| SMILES | N#CCc1cc(Nc2ccc(Br)cc2Br)ccc1N |
| InChI | InChI=1S/C14H11Br2N3/c15-10-1-4-14(12(16)8-10)19-11-2-3-13(18)9(7-11)5-6-17/h1-4,7-8,19H,5,18H2 |
| InChIKey | JDAIGZCJRLSYRO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.07 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|