C12H15N3 — CID 102624243
2-[2-amino-5-(cyclobutylamino)phenyl]acetonitrile (PubChem CID 102624243) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[2-amino-5-(cyclobutylamino)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(cyclobutylamino)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624243 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-[2-amino-5-(cyclobutylamino)phenyl]acetonitrile |
| SMILES | N#CCc1cc(NC2CCC2)ccc1N |
| InChI | InChI=1S/C12H15N3/c13-7-6-9-8-11(4-5-12(9)14)15-10-2-1-3-10/h4-5,8,10,15H,1-3,6,14H2 |
| InChIKey | WNMXHKDFBGCELF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|