C15H18N4O — CID 102624588
2-[2-amino-5-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)phenyl]acetonitrile (PubChem CID 102624588) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-[2-amino-5-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624588 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[2-amino-5-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)phenyl]acetonitrile |
| SMILES | N#CCc1cc(N2CCN3C(=O)CCC3C2)ccc1N |
| InChI | InChI=1S/C15H18N4O/c16-6-5-11-9-12(1-3-14(11)17)18-7-8-19-13(10-18)2-4-15(19)20/h1,3,9,13H,2,4-5,7-8,10,17H2 |
| InChIKey | SEXKAHPHCQKOJS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|