C12H13N5 — CID 102624772
2-[2-amino-5-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]acetonitrile (PubChem CID 102624772) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[2-amino-5-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624772 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[2-amino-5-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]acetonitrile |
| SMILES | Cc1nc(C)n(-c2ccc(N)c(CC#N)c2)n1 |
| InChI | InChI=1S/C12H13N5/c1-8-15-9(2)17(16-8)11-3-4-12(14)10(7-11)5-6-13/h3-4,7H,5,14H2,1-2H3 |
| InChIKey | YKIWZWIKAGFMQM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|