C10H10O5 — CID 10262521
dimethyl (1R,4S)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 10262521) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is dimethyl (1R,4S)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,4S)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10262521 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | dimethyl (1R,4S)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C10H10O5/c1-13-9(11)7-5-3-4-6(15-5)8(7)10(12)14-2/h3-6H,1-2H3/t5-,6+ |
| InChIKey | FQVSHUVBNGSEJO-OLQVQODUSA-N |
| XLogP | -0.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|