About 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide
3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide (PubChem CID 102625286) has the molecular formula C13H19N5
and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide.
Molecular Properties
| Compound Name | 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide |
| PubChem CID | 102625286 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN(CC)c1cccc2nccn12 |
| InChI | InChI=1S/C13H19N5/c1-3-17(9-10(2)13(14)15)12-6-4-5-11-16-7-8-18(11)12/h4-8,10H,3,9H2,1-2H3,(H3,14,15) |
| InChIKey | ZCRQSLXVTDKPCN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide?
The IUPAC name of 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide (CID 102625286) is 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide.
What is the SMILES notation for 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide?
The canonical SMILES for 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide is [H]/N=C(\N)C(C)CN(CC)c1cccc2nccn12.
What is the InChIKey of 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide?
The InChIKey is ZCRQSLXVTDKPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5/c1-3-17(9-10(2)13(14)15)12-6-4-5-11-16-7-8-18(11)12/h4-8,10H,3,9H2,1-2H3,(H3,14,15).
What are the key properties of 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide?
3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide has a molecular weight of 245.33 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(imidazo[1,2-a]pyridin-5-yl)amino]-2-methylpropanimidamide is sourced from PubChem (CID 102625286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).