About 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine
8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine (PubChem CID 102626151) has the molecular formula C14H18N4O
and a molecular weight of 258.32 g/mol. Its IUPAC name is 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine.
Molecular Properties
| Compound Name | 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| PubChem CID | 102626151 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| SMILES | NC1C2CCCOC2C1Nc1cccc2nccn12 |
| InChI | InChI=1S/C14H18N4O/c15-12-9-3-2-8-19-14(9)13(12)17-11-5-1-4-10-16-6-7-18(10)11/h1,4-7,9,12-14,17H,2-3,8,15H2 |
| InChIKey | MHTYZTLCKMVMEI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The IUPAC name of 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine (CID 102626151) is 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine.
What is the SMILES notation for 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The canonical SMILES for 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine is NC1C2CCCOC2C1Nc1cccc2nccn12.
What is the InChIKey of 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The InChIKey is MHTYZTLCKMVMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O/c15-12-9-3-2-8-19-14(9)13(12)17-11-5-1-4-10-16-6-7-18(10)11/h1,4-7,9,12-14,17H,2-3,8,15H2.
What are the key properties of 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine?
8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine has a molecular weight of 258.32 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-imidazo[1,2-a]pyridin-5-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine is sourced from PubChem (CID 102626151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).