C12H11N3S — CID 102626306
(5-imidazo[1,2-a]pyridin-5-ylthiophen-2-yl)methanamine (PubChem CID 102626306) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is (5-imidazo[1,2-a]pyridin-5-ylthiophen-2-yl)methanamine.
| Compound Name | (5-imidazo[1,2-a]pyridin-5-ylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 102626306 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (5-imidazo[1,2-a]pyridin-5-ylthiophen-2-yl)methanamine |
| SMILES | NCc1ccc(-c2cccc3nccn23)s1 |
| InChI | InChI=1S/C12H11N3S/c13-8-9-4-5-11(16-9)10-2-1-3-12-14-6-7-15(10)12/h1-7H,8,13H2 |
| InChIKey | LNZWRKYBXILVJX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |