C17H18FN3 — CID 102626421
N-[(3-fluoro-4-imidazo[1,2-a]pyridin-5-ylphenyl)methyl]propan-1-amine (PubChem CID 102626421) has the molecular formula C17H18FN3 and a molecular weight of 283.35 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazo[1,2-a]pyridin-5-ylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-fluoro-4-imidazo[1,2-a]pyridin-5-ylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102626421 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-[(3-fluoro-4-imidazo[1,2-a]pyridin-5-ylphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2cccc3nccn23)c(F)c1 |
| InChI | InChI=1S/C17H18FN3/c1-2-8-19-12-13-6-7-14(15(18)11-13)16-4-3-5-17-20-9-10-21(16)17/h3-7,9-11,19H,2,8,12H2,1H3 |
| InChIKey | BFWCMBNZAFQXRH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|