About 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol
3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol (PubChem CID 102627018) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol.
Molecular Properties
| Compound Name | 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol |
| PubChem CID | 102627018 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol |
| SMILES | NCC(CO)c1cccc2nccn12 |
| InChI | InChI=1S/C10H13N3O/c11-6-8(7-14)9-2-1-3-10-12-4-5-13(9)10/h1-5,8,14H,6-7,11H2 |
| InChIKey | YMXYKKVQUXJHHN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol?
The IUPAC name of 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol (CID 102627018) is 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol.
What is the SMILES notation for 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol?
The canonical SMILES for 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol is NCC(CO)c1cccc2nccn12.
What is the InChIKey of 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol?
The InChIKey is YMXYKKVQUXJHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c11-6-8(7-14)9-2-1-3-10-12-4-5-13(9)10/h1-5,8,14H,6-7,11H2.
What are the key properties of 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol?
3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol has a molecular weight of 191.23 g/mol, XLogP of 0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-imidazo[1,2-a]pyridin-5-ylpropan-1-ol is sourced from PubChem (CID 102627018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).