C12H14BrN3 — CID 102627084
5-[2-(bromomethyl)pyrrolidin-1-yl]imidazo[1,2-a]pyridine (PubChem CID 102627084) has the molecular formula C12H14BrN3 and a molecular weight of 280.17 g/mol. Its IUPAC name is 5-[2-(bromomethyl)pyrrolidin-1-yl]imidazo[1,2-a]pyridine.
| Compound Name | 5-[2-(bromomethyl)pyrrolidin-1-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 102627084 |
| Molecular Formula | C12H14BrN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-[2-(bromomethyl)pyrrolidin-1-yl]imidazo[1,2-a]pyridine |
| SMILES | BrCC1CCCN1c1cccc2nccn12 |
| InChI | InChI=1S/C12H14BrN3/c13-9-10-3-2-7-15(10)12-5-1-4-11-14-6-8-16(11)12/h1,4-6,8,10H,2-3,7,9H2 |
| InChIKey | VCSZZZXULJOSHF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|