About 3-methylsulfonylpropyl methanesulfonate
3-methylsulfonylpropyl methanesulfonate (PubChem CID 10262758) has the molecular formula C5H12O5S2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-methylsulfonylpropyl methanesulfonate.
Molecular Properties
| Compound Name | 3-methylsulfonylpropyl methanesulfonate |
| PubChem CID | 10262758 |
| Molecular Formula | C5H12O5S2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 3-methylsulfonylpropyl methanesulfonate |
| SMILES | CS(=O)(=O)CCCOS(C)(=O)=O |
| InChI | InChI=1S/C5H12O5S2/c1-11(6,7)5-3-4-10-12(2,8)9/h3-5H2,1-2H3 |
| InChIKey | BZQGPGKJLOOSFU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfonylpropyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonylpropyl methanesulfonate?
The IUPAC name of 3-methylsulfonylpropyl methanesulfonate (CID 10262758) is 3-methylsulfonylpropyl methanesulfonate.
What is the SMILES notation for 3-methylsulfonylpropyl methanesulfonate?
The canonical SMILES for 3-methylsulfonylpropyl methanesulfonate is CS(=O)(=O)CCCOS(C)(=O)=O.
What is the InChIKey of 3-methylsulfonylpropyl methanesulfonate?
The InChIKey is BZQGPGKJLOOSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O5S2/c1-11(6,7)5-3-4-10-12(2,8)9/h3-5H2,1-2H3.
What are the key properties of 3-methylsulfonylpropyl methanesulfonate?
3-methylsulfonylpropyl methanesulfonate has a molecular weight of 216.28 g/mol, XLogP of -0.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonylpropyl methanesulfonate is sourced from PubChem (CID 10262758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).