C17H36N2 — CID 102627751
4-[(heptan-2-ylamino)methyl]-2,3,3-trimethylcyclohexan-1-amine (PubChem CID 102627751) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 4-[(heptan-2-ylamino)methyl]-2,3,3-trimethylcyclohexan-1-amine.
| Compound Name | 4-[(heptan-2-ylamino)methyl]-2,3,3-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102627751 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 4-[(heptan-2-ylamino)methyl]-2,3,3-trimethylcyclohexan-1-amine |
| SMILES | CCCCCC(C)NCC1CCC(N)C(C)C1(C)C |
| InChI | InChI=1S/C17H36N2/c1-6-7-8-9-13(2)19-12-15-10-11-16(18)14(3)17(15,4)5/h13-16,19H,6-12,18H2,1-5H3 |
| InChIKey | ZRYNFRXMKPSINJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|