C13H15NO2 — CID 10262798
[(4S,5S)-2-benzyl-5-ethenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol (PubChem CID 10262798) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is [(4S,5S)-2-benzyl-5-ethenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol.
| Compound Name | [(4S,5S)-2-benzyl-5-ethenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 10262798 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [(4S,5S)-2-benzyl-5-ethenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol |
| SMILES | C=C[C@@H]1OC(Cc2ccccc2)=N[C@H]1CO |
| InChI | InChI=1S/C13H15NO2/c1-2-12-11(9-15)14-13(16-12)8-10-6-4-3-5-7-10/h2-7,11-12,15H,1,8-9H2/t11-,12-/m0/s1 |
| InChIKey | FLKISSURPVEJPE-RYUDHWBXSA-N |
| XLogP | 1.57 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|