C16H23NO4 — CID 102628040
4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2,2,3-trimethylcyclohexane-1-carboxylic acid (PubChem CID 102628040) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2,2,3-trimethylcyclohexane-1-carboxylic acid.
| Compound Name | 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2,2,3-trimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102628040 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2,2,3-trimethylcyclohexane-1-carboxylic acid |
| SMILES | CC1=C(C)C(=O)N(C2CCC(C(=O)O)C(C)(C)C2C)C1=O |
| InChI | InChI=1S/C16H23NO4/c1-8-9(2)14(19)17(13(8)18)12-7-6-11(15(20)21)16(4,5)10(12)3/h10-12H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | NHZLXHUVRIKEIN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|