C14H23N3O3 — CID 102628989
4-(4-amino-2,2,3-trimethylcyclohexanecarbonyl)piperazine-2,6-dione (PubChem CID 102628989) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(4-amino-2,2,3-trimethylcyclohexanecarbonyl)piperazine-2,6-dione.
| Compound Name | 4-(4-amino-2,2,3-trimethylcyclohexanecarbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 102628989 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-(4-amino-2,2,3-trimethylcyclohexanecarbonyl)piperazine-2,6-dione |
| SMILES | CC1C(N)CCC(C(=O)N2CC(=O)NC(=O)C2)C1(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-8-10(15)5-4-9(14(8,2)3)13(20)17-6-11(18)16-12(19)7-17/h8-10H,4-7,15H2,1-3H3,(H,16,18,19) |
| InChIKey | ZKRPNQHCPUXTMQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|