About 4,7-diethoxy-2,3-dihydroinden-1-one
4,7-diethoxy-2,3-dihydroinden-1-one (PubChem CID 10262901) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 4,7-diethoxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 4,7-diethoxy-2,3-dihydroinden-1-one |
| PubChem CID | 10262901 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4,7-diethoxy-2,3-dihydroinden-1-one |
| SMILES | CCOc1ccc(OCC)c2c1CCC2=O |
| InChI | InChI=1S/C13H16O3/c1-3-15-11-7-8-12(16-4-2)13-9(11)5-6-10(13)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | PIDGSRXEVPLIOE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-diethoxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diethoxy-2,3-dihydroinden-1-one?
The IUPAC name of 4,7-diethoxy-2,3-dihydroinden-1-one (CID 10262901) is 4,7-diethoxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 4,7-diethoxy-2,3-dihydroinden-1-one?
The canonical SMILES for 4,7-diethoxy-2,3-dihydroinden-1-one is CCOc1ccc(OCC)c2c1CCC2=O.
What is the InChIKey of 4,7-diethoxy-2,3-dihydroinden-1-one?
The InChIKey is PIDGSRXEVPLIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-3-15-11-7-8-12(16-4-2)13-9(11)5-6-10(13)14/h7-8H,3-6H2,1-2H3.
What are the key properties of 4,7-diethoxy-2,3-dihydroinden-1-one?
4,7-diethoxy-2,3-dihydroinden-1-one has a molecular weight of 220.27 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diethoxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 10262901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).