1-amino-2,3-dihydroindene-1,4-dicarboxylic acid

C11H11NO4 — CID 10262931

IUPAC1-amino-2,3-dihydroindene-1,4-dicarboxylic acid
SMILESNC1(C(=O)O)CCc2c(C(=O)O)cccc21
InChIInChI=1S/C11H11NO4/c12-11(10(15)16)5-4-6-7(9(13)14)2-1-3-8(6)11/h1-3H,4-5,12H2,(H,13,14)(H,15,16)
InChIKeyPPMZIAQYCHLAEQ-UHFFFAOYSA-N
MW221.21 g/mol
LogP0.57
Rot. Bonds2

About 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid

1-amino-2,3-dihydroindene-1,4-dicarboxylic acid (PubChem CID 10262931) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid.

Molecular Properties

Compound Name1-amino-2,3-dihydroindene-1,4-dicarboxylic acid
PubChem CID10262931
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name1-amino-2,3-dihydroindene-1,4-dicarboxylic acid
SMILESNC1(C(=O)O)CCc2c(C(=O)O)cccc21
InChIInChI=1S/C11H11NO4/c12-11(10(15)16)5-4-6-7(9(13)14)2-1-3-8(6)11/h1-3H,4-5,12H2,(H,13,14)(H,15,16)
InChIKeyPPMZIAQYCHLAEQ-UHFFFAOYSA-N
XLogP0.57
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 50.57
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid?
The IUPAC name of 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid (CID 10262931) is 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid.
What is the SMILES notation for 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid?
The canonical SMILES for 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid is NC1(C(=O)O)CCc2c(C(=O)O)cccc21.
What is the InChIKey of 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid?
The InChIKey is PPMZIAQYCHLAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c12-11(10(15)16)5-4-6-7(9(13)14)2-1-3-8(6)11/h1-3H,4-5,12H2,(H,13,14)(H,15,16).
What are the key properties of 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid?
1-amino-2,3-dihydroindene-1,4-dicarboxylic acid has a molecular weight of 221.21 g/mol, XLogP of 0.57, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,3-dihydroindene-1,4-dicarboxylic acid is sourced from PubChem (CID 10262931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).