C15H25N5O — CID 102629319
4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,2,3-trimethylcyclohexane-1-carboxamide (PubChem CID 102629319) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,2,3-trimethylcyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,2,3-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102629319 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,2,3-trimethylcyclohexane-1-carboxamide |
| SMILES | Cc1nnc(NC(=O)C2CCC(N)C(C)C2(C)C)nc1C |
| InChI | InChI=1S/C15H25N5O/c1-8-12(16)7-6-11(15(8,4)5)13(21)18-14-17-9(2)10(3)19-20-14/h8,11-12H,6-7,16H2,1-5H3,(H,17,18,20,21) |
| InChIKey | PUFASELWPGCFFU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |