C13H21N5S — CID 102629487
2,3,3-trimethyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)cyclohexan-1-amine (PubChem CID 102629487) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)cyclohexan-1-amine.
| Compound Name | 2,3,3-trimethyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 102629487 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2,3,3-trimethyl-4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)cyclohexan-1-amine |
| SMILES | Cc1nnc2sc(C3CCC(N)C(C)C3(C)C)nn12 |
| InChI | InChI=1S/C13H21N5S/c1-7-10(14)6-5-9(13(7,3)4)11-17-18-8(2)15-16-12(18)19-11/h7,9-10H,5-6,14H2,1-4H3 |
| InChIKey | MCEVGAAEQNJSCF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |