C16H21BrN2O — CID 102629616
4-(7-bromo-1,3-benzoxazol-2-yl)-2,3,3-trimethylcyclohexan-1-amine (PubChem CID 102629616) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 4-(7-bromo-1,3-benzoxazol-2-yl)-2,3,3-trimethylcyclohexan-1-amine.
| Compound Name | 4-(7-bromo-1,3-benzoxazol-2-yl)-2,3,3-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102629616 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-(7-bromo-1,3-benzoxazol-2-yl)-2,3,3-trimethylcyclohexan-1-amine |
| SMILES | CC1C(N)CCC(c2nc3cccc(Br)c3o2)C1(C)C |
| InChI | InChI=1S/C16H21BrN2O/c1-9-12(18)8-7-10(16(9,2)3)15-19-13-6-4-5-11(17)14(13)20-15/h4-6,9-10,12H,7-8,18H2,1-3H3 |
| InChIKey | RBMKGOCCAXYGPZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |