C16H28N2O3 — CID 102630332
4-[[ethyl(prop-2-enyl)carbamoyl]amino]-2,2,3-trimethylcyclohexane-1-carboxylic acid (PubChem CID 102630332) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-[[ethyl(prop-2-enyl)carbamoyl]amino]-2,2,3-trimethylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[[ethyl(prop-2-enyl)carbamoyl]amino]-2,2,3-trimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102630332 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 4-[[ethyl(prop-2-enyl)carbamoyl]amino]-2,2,3-trimethylcyclohexane-1-carboxylic acid |
| SMILES | C=CCN(CC)C(=O)NC1CCC(C(=O)O)C(C)(C)C1C |
| InChI | InChI=1S/C16H28N2O3/c1-6-10-18(7-2)15(21)17-13-9-8-12(14(19)20)16(4,5)11(13)3/h6,11-13H,1,7-10H2,2-5H3,(H,17,21)(H,19,20) |
| InChIKey | RMWGRBYWCRNMOL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|