About N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide
N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide (PubChem CID 10263040) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide.
Molecular Properties
| Compound Name | N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide |
| PubChem CID | 10263040 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide |
| SMILES | CCC(=O)NCc1c(O)c(=O)cc(C)n1C |
| InChI | InChI=1S/C11H16N2O3/c1-4-10(15)12-6-8-11(16)9(14)5-7(2)13(8)3/h5,16H,4,6H2,1-3H3,(H,12,15) |
| InChIKey | SBENANDJCBTBOY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide?
The IUPAC name of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide (CID 10263040) is N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide.
What is the SMILES notation for N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide?
The canonical SMILES for N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide is CCC(=O)NCc1c(O)c(=O)cc(C)n1C.
What is the InChIKey of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide?
The InChIKey is SBENANDJCBTBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-4-10(15)12-6-8-11(16)9(14)5-7(2)13(8)3/h5,16H,4,6H2,1-3H3,(H,12,15).
What are the key properties of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide?
N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide has a molecular weight of 224.26 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]propanamide is sourced from PubChem (CID 10263040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).