C15H30N2O2 — CID 102630939
4-[3-(dimethylamino)propylamino]-2,2,3-trimethylcyclohexane-1-carboxylic acid (PubChem CID 102630939) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylamino]-2,2,3-trimethylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(dimethylamino)propylamino]-2,2,3-trimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102630939 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 4-[3-(dimethylamino)propylamino]-2,2,3-trimethylcyclohexane-1-carboxylic acid |
| SMILES | CC1C(NCCCN(C)C)CCC(C(=O)O)C1(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-11-13(16-9-6-10-17(4)5)8-7-12(14(18)19)15(11,2)3/h11-13,16H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | UAVPYQBOZFZXGN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|