C11H20BrNO2 — CID 102631757
2-bromo-N-(2-hydroxycyclohexyl)-N,2-dimethylpropanamide (PubChem CID 102631757) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-bromo-N-(2-hydroxycyclohexyl)-N,2-dimethylpropanamide.
| Compound Name | 2-bromo-N-(2-hydroxycyclohexyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 102631757 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-bromo-N-(2-hydroxycyclohexyl)-N,2-dimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)Br)C1CCCCC1O |
| InChI | InChI=1S/C11H20BrNO2/c1-11(2,12)10(15)13(3)8-6-4-5-7-9(8)14/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | OWFAYISXQMHJDQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|