C13H24O3 — CID 10263187
(2E,4S,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol (PubChem CID 10263187) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (2E,4S,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol.
| Compound Name | (2E,4S,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol |
|---|---|
| PubChem CID | 10263187 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2E,4S,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol |
| SMILES | C/C=C/[C@@H](O)C/C(C)=C\[C@@H](C)COCOC |
| InChI | InChI=1S/C13H24O3/c1-5-6-13(14)8-11(2)7-12(3)9-16-10-15-4/h5-7,12-14H,8-10H2,1-4H3/b6-5+,11-7-/t12-,13-/m1/s1 |
| InChIKey | PPGLVCBDHYIGHA-IASRUXGTSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|