C11H18O5 — CID 10263238
1,3,3,6,6-pentamethoxycyclohexa-1,4-diene (PubChem CID 10263238) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1,3,3,6,6-pentamethoxycyclohexa-1,4-diene.
| Compound Name | 1,3,3,6,6-pentamethoxycyclohexa-1,4-diene |
|---|---|
| PubChem CID | 10263238 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1,3,3,6,6-pentamethoxycyclohexa-1,4-diene |
| SMILES | COC1=CC(OC)(OC)C=CC1(OC)OC |
| InChI | InChI=1S/C11H18O5/c1-12-9-8-10(13-2,14-3)6-7-11(9,15-4)16-5/h6-8H,1-5H3 |
| InChIKey | UCXXVIYJSYAGOC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|