C16H22N2O2 — CID 102632839
3-[(2-hydroxycyclohexyl)-methylamino]-4-[(1S)-1-hydroxyethyl]benzonitrile (PubChem CID 102632839) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-[(2-hydroxycyclohexyl)-methylamino]-4-[(1S)-1-hydroxyethyl]benzonitrile.
| Compound Name | 3-[(2-hydroxycyclohexyl)-methylamino]-4-[(1S)-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 102632839 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-[(2-hydroxycyclohexyl)-methylamino]-4-[(1S)-1-hydroxyethyl]benzonitrile |
| SMILES | C[C@H](O)c1ccc(C#N)cc1N(C)C1CCCCC1O |
| InChI | InChI=1S/C16H22N2O2/c1-11(19)13-8-7-12(10-17)9-15(13)18(2)14-5-3-4-6-16(14)20/h7-9,11,14,16,19-20H,3-6H2,1-2H3/t11-,14?,16?/m0/s1 |
| InChIKey | FHFYGECHVWDCHH-WJFWJRBTSA-N |
| XLogP | 2.35 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |