C17H25ClN2O — CID 102633000
2-[2-chloro-4-[(cyclopropylamino)methyl]-N-methylanilino]cyclohexan-1-ol (PubChem CID 102633000) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 2-[2-chloro-4-[(cyclopropylamino)methyl]-N-methylanilino]cyclohexan-1-ol.
| Compound Name | 2-[2-chloro-4-[(cyclopropylamino)methyl]-N-methylanilino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102633000 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[2-chloro-4-[(cyclopropylamino)methyl]-N-methylanilino]cyclohexan-1-ol |
| SMILES | CN(c1ccc(CNC2CC2)cc1Cl)C1CCCCC1O |
| InChI | InChI=1S/C17H25ClN2O/c1-20(16-4-2-3-5-17(16)21)15-9-6-12(10-14(15)18)11-19-13-7-8-13/h6,9-10,13,16-17,19,21H,2-5,7-8,11H2,1H3 |
| InChIKey | MBQNBRACQJHRQQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|