C10H18ClNO — CID 102633139
2-[(E)-3-chloroprop-2-enoxy]-N-methylcyclohexan-1-amine (PubChem CID 102633139) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is 2-[(E)-3-chloroprop-2-enoxy]-N-methylcyclohexan-1-amine.
| Compound Name | 2-[(E)-3-chloroprop-2-enoxy]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102633139 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-[(E)-3-chloroprop-2-enoxy]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCCCC1OC/C=C/Cl |
| InChI | InChI=1S/C10H18ClNO/c1-12-9-5-2-3-6-10(9)13-8-4-7-11/h4,7,9-10,12H,2-3,5-6,8H2,1H3/b7-4+ |
| InChIKey | VWRLTCGWADSTGC-QPJJXVBHSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |