About 4-[(E)-dec-4-enyl]phenol
4-[(E)-dec-4-enyl]phenol (PubChem CID 10263365) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-[(E)-dec-4-enyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-dec-4-enyl]phenol |
| PubChem CID | 10263365 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-[(E)-dec-4-enyl]phenol |
| SMILES | CCCCC/C=C/CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C16H24O/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h6-7,11-14,17H,2-5,8-10H2,1H3/b7-6+ |
| InChIKey | LMJPVRXXPPOFAM-VOTSOKGWSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-dec-4-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-dec-4-enyl]phenol?
The IUPAC name of 4-[(E)-dec-4-enyl]phenol (CID 10263365) is 4-[(E)-dec-4-enyl]phenol.
What is the SMILES notation for 4-[(E)-dec-4-enyl]phenol?
The canonical SMILES for 4-[(E)-dec-4-enyl]phenol is CCCCC/C=C/CCCc1ccc(O)cc1.
What is the InChIKey of 4-[(E)-dec-4-enyl]phenol?
The InChIKey is LMJPVRXXPPOFAM-VOTSOKGWSA-N. The full InChI is InChI=1S/C16H24O/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h6-7,11-14,17H,2-5,8-10H2,1H3/b7-6+.
What are the key properties of 4-[(E)-dec-4-enyl]phenol?
4-[(E)-dec-4-enyl]phenol has a molecular weight of 232.37 g/mol, XLogP of 4.85, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-dec-4-enyl]phenol is sourced from PubChem (CID 10263365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).