C9H10Cl2N2O — CID 10263376
5-[[(2S)-azetidin-2-yl]methoxy]-2,3-dichloropyridine (PubChem CID 10263376) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is 5-[[(2S)-azetidin-2-yl]methoxy]-2,3-dichloropyridine.
| Compound Name | 5-[[(2S)-azetidin-2-yl]methoxy]-2,3-dichloropyridine |
|---|---|
| PubChem CID | 10263376 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 5-[[(2S)-azetidin-2-yl]methoxy]-2,3-dichloropyridine |
| SMILES | Clc1cc(OC[C@@H]2CCN2)cnc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O/c10-8-3-7(4-13-9(8)11)14-5-6-1-2-12-6/h3-4,6,12H,1-2,5H2/t6-/m0/s1 |
| InChIKey | CUMDMICZFUURRT-LURJTMIESA-N |
| XLogP | 2.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|