C14H18F3NO3 — CID 102634052
2-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxymethyl]morpholine (PubChem CID 102634052) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxymethyl]morpholine.
| Compound Name | 2-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxymethyl]morpholine |
|---|---|
| PubChem CID | 102634052 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxymethyl]morpholine |
| SMILES | CC1CNCC(COCc2ccc(OC(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C14H18F3NO3/c1-10-6-18-7-13(20-10)9-19-8-11-2-4-12(5-3-11)21-14(15,16)17/h2-5,10,13,18H,6-9H2,1H3 |
| InChIKey | VWPXJAPIKDRJDV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |