C15H19F2NO2 — CID 102634808
2,6-difluoro-N-(2-hydroxycyclohexyl)-N,3-dimethylbenzamide (PubChem CID 102634808) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-hydroxycyclohexyl)-N,3-dimethylbenzamide.
| Compound Name | 2,6-difluoro-N-(2-hydroxycyclohexyl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 102634808 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2,6-difluoro-N-(2-hydroxycyclohexyl)-N,3-dimethylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)C2CCCCC2O)c1F |
| InChI | InChI=1S/C15H19F2NO2/c1-9-7-8-10(16)13(14(9)17)15(20)18(2)11-5-3-4-6-12(11)19/h7-8,11-12,19H,3-6H2,1-2H3 |
| InChIKey | IAFXTAGNBVRCRE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |