C15H24O2 — CID 10263523
2-[[(1R,3aS,6aS)-1,3a,6a-trimethyl-5,6-dihydro-4H-pentalen-1-yl]methyl]-1,3-dioxolane (PubChem CID 10263523) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-[[(1R,3aS,6aS)-1,3a,6a-trimethyl-5,6-dihydro-4H-pentalen-1-yl]methyl]-1,3-dioxolane.
| Compound Name | 2-[[(1R,3aS,6aS)-1,3a,6a-trimethyl-5,6-dihydro-4H-pentalen-1-yl]methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10263523 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-[[(1R,3aS,6aS)-1,3a,6a-trimethyl-5,6-dihydro-4H-pentalen-1-yl]methyl]-1,3-dioxolane |
| SMILES | C[C@]12CCC[C@@]1(C)C=C[C@@]2(C)CC1OCCO1 |
| InChI | InChI=1S/C15H24O2/c1-13-5-4-6-15(13,3)14(2,8-7-13)11-12-16-9-10-17-12/h7-8,12H,4-6,9-11H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | XGFATGUKZBERFV-KKUMJFAQSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|