C12H17FN2O — CID 102635994
2-[(3-fluoro-2-pyridinyl)-methylamino]cyclohexan-1-ol (PubChem CID 102635994) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-[(3-fluoro-2-pyridinyl)-methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(3-fluoro-2-pyridinyl)-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102635994 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[(3-fluoro-2-pyridinyl)-methylamino]cyclohexan-1-ol |
| SMILES | CN(c1ncccc1F)C1CCCCC1O |
| InChI | InChI=1S/C12H17FN2O/c1-15(10-6-2-3-7-11(10)16)12-9(13)5-4-8-14-12/h4-5,8,10-11,16H,2-3,6-7H2,1H3 |
| InChIKey | WGHIHXUZQHIJAM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |