C18H24 — CID 10263693
(5Z)-5-prop-1-ynylpentadeca-1,5,7,8,14-pentaene (PubChem CID 10263693) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (5Z)-5-prop-1-ynylpentadeca-1,5,7,8,14-pentaene.
| Compound Name | (5Z)-5-prop-1-ynylpentadeca-1,5,7,8,14-pentaene |
|---|---|
| PubChem CID | 10263693 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (5Z)-5-prop-1-ynylpentadeca-1,5,7,8,14-pentaene |
| SMILES | C=CCCCCC=C=C/C=C(\C#CC)CCC=C |
| InChI | InChI=1S/C18H24/c1-4-7-9-10-11-12-13-14-17-18(15-6-3)16-8-5-2/h4-5,12,14,17H,1-2,7-11,16H2,3H3/b18-17+ |
| InChIKey | CXHKQNFKZTTZSV-ISLYRVAYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|