C16H24BrNO2 — CID 102637367
2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylcyclohexan-1-amine (PubChem CID 102637367) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylcyclohexan-1-amine.
| Compound Name | 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102637367 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylcyclohexan-1-amine |
| SMILES | COc1ccc(CN(C)C2CCCCC2Br)cc1OC |
| InChI | InChI=1S/C16H24BrNO2/c1-18(14-7-5-4-6-13(14)17)11-12-8-9-15(19-2)16(10-12)20-3/h8-10,13-14H,4-7,11H2,1-3H3 |
| InChIKey | ZXFXPMWILIEWEC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|