C16H20BrN3 — CID 102637599
N-(2-bromocyclohexyl)-N,4-dimethylphthalazin-1-amine (PubChem CID 102637599) has the molecular formula C16H20BrN3 and a molecular weight of 334.26 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,4-dimethylphthalazin-1-amine.
| Compound Name | N-(2-bromocyclohexyl)-N,4-dimethylphthalazin-1-amine |
|---|---|
| PubChem CID | 102637599 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,4-dimethylphthalazin-1-amine |
| SMILES | Cc1nnc(N(C)C2CCCCC2Br)c2ccccc12 |
| InChI | InChI=1S/C16H20BrN3/c1-11-12-7-3-4-8-13(12)16(19-18-11)20(2)15-10-6-5-9-14(15)17/h3-4,7-8,14-15H,5-6,9-10H2,1-2H3 |
| InChIKey | NVBXJOKAVBSZGI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|